C15H13F2N3O2 — CID 168532086
[[3-[(2,4-difluorophenyl)methoxy]phenyl]methylideneamino]urea (PubChem CID 168532086) has the molecular formula C15H13F2N3O2 and a molecular weight of 305.28 g/mol. Its IUPAC name is [[3-[(2,4-difluorophenyl)methoxy]phenyl]methylideneamino]urea.
| Compound Name | [[3-[(2,4-difluorophenyl)methoxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168532086 |
| Molecular Formula | C15H13F2N3O2 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | [[3-[(2,4-difluorophenyl)methoxy]phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1cccc(OCc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H13F2N3O2/c16-12-5-4-11(14(17)7-12)9-22-13-3-1-2-10(6-13)8-19-20-15(18)21/h1-8H,9H2,(H3,18,20,21) |
| InChIKey | IMJHMNRQSVRTHI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|