C16H24N4O2 — CID 168533022
[[2-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]methylideneamino]urea (PubChem CID 168533022) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is [[2-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]methylideneamino]urea.
| Compound Name | [[2-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533022 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | [[2-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]methylideneamino]urea |
| SMILES | CC1CCCN(CCOc2ccccc2C=NNC(N)=O)C1 |
| InChI | InChI=1S/C16H24N4O2/c1-13-5-4-8-20(12-13)9-10-22-15-7-3-2-6-14(15)11-18-19-16(17)21/h2-3,6-7,11,13H,4-5,8-10,12H2,1H3,(H3,17,19,21) |
| InChIKey | AUGPQTQFFJLPLX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|