C15H17FN6O2S — CID 168535525
[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 168535525) has the molecular formula C15H17FN6O2S and a molecular weight of 364.41 g/mol. Its IUPAC name is [[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535525 |
| Molecular Formula | C15H17FN6O2S |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(F)c(-c2noc(CN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C15H17FN6O2S/c16-12-2-1-10(8-18-20-15(17)25)7-11(12)14-19-13(24-21-14)9-22-3-5-23-6-4-22/h1-2,7-8H,3-6,9H2,(H3,17,20,25) |
| InChIKey | XYWNTUNGUUAFBQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|