C17H18N2O6 — CID 168536771
2,2-dimethyl-5-[[4-[(2-oxo-1,3-oxazolidin-4-yl)methyl]anilino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168536771) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[4-[(2-oxo-1,3-oxazolidin-4-yl)methyl]anilino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[4-[(2-oxo-1,3-oxazolidin-4-yl)methyl]anilino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168536771 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2,2-dimethyl-5-[[4-[(2-oxo-1,3-oxazolidin-4-yl)methyl]anilino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc(CC3COC(=O)N3)cc2)C(=O)O1 |
| InChI | InChI=1S/C17H18N2O6/c1-17(2)24-14(20)13(15(21)25-17)8-18-11-5-3-10(4-6-11)7-12-9-23-16(22)19-12/h3-6,8,12,18H,7,9H2,1-2H3,(H,19,22) |
| InChIKey | SRRKXDPGRFGZCO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|