C18H20N2O4 — CID 168537050
5-tert-butyl-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzonitrile (PubChem CID 168537050) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-tert-butyl-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzonitrile.
| Compound Name | 5-tert-butyl-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzonitrile |
|---|---|
| PubChem CID | 168537050 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-tert-butyl-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzonitrile |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc(C(C)(C)C)cc2C#N)C(=O)O1 |
| InChI | InChI=1S/C18H20N2O4/c1-17(2,3)12-6-7-14(11(8-12)9-19)20-10-13-15(21)23-18(4,5)24-16(13)22/h6-8,10,20H,1-5H3 |
| InChIKey | URMBQKQDIYNJSQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|