C16H13F6NO5 — CID 168537628
5-[[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168537628) has the molecular formula C16H13F6NO5 and a molecular weight of 413.27 g/mol. Its IUPAC name is 5-[[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168537628 |
| Molecular Formula | C16H13F6NO5 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 5-[[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccccc2C(O)(C(F)(F)F)C(F)(F)F)C(=O)O1 |
| InChI | InChI=1S/C16H13F6NO5/c1-13(2)27-11(24)8(12(25)28-13)7-23-10-6-4-3-5-9(10)14(26,15(17,18)19)16(20,21)22/h3-7,23,26H,1-2H3 |
| InChIKey | OERFFDYNTRQLOV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|