C18H18N2O5S — CID 168537947
5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-N,N-dimethyl-1-benzothiophene-2-carboxamide (PubChem CID 168537947) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-N,N-dimethyl-1-benzothiophene-2-carboxamide.
| Compound Name | 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-N,N-dimethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 168537947 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-N,N-dimethyl-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cc(NC=C3C(=O)OC(C)(C)OC3=O)ccc2s1 |
| InChI | InChI=1S/C18H18N2O5S/c1-18(2)24-16(22)12(17(23)25-18)9-19-11-5-6-13-10(7-11)8-14(26-13)15(21)20(3)4/h5-9,19H,1-4H3 |
| InChIKey | NJGIHNPZVBRSSC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|