C18H22N2O5 — CID 168538433
3-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-N,N-dimethylpropanamide (PubChem CID 168538433) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 168538433 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCc1ccccc1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C18H22N2O5/c1-18(2)24-16(22)13(17(23)25-18)11-19-14-8-6-5-7-12(14)9-10-15(21)20(3)4/h5-8,11,19H,9-10H2,1-4H3 |
| InChIKey | PAGFRAZEWFKXKK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|