C16H16N2O5 — CID 168539108
2,2-dimethyl-5-[[(1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168539108) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[(1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[(1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168539108 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2,2-dimethyl-5-[[(1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2cccc3c2CCNC3=O)C(=O)O1 |
| InChI | InChI=1S/C16H16N2O5/c1-16(2)22-14(20)11(15(21)23-16)8-18-12-5-3-4-10-9(12)6-7-17-13(10)19/h3-5,8,18H,6-7H2,1-2H3,(H,17,19) |
| InChIKey | GDHGKYGYJSCJSU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|