C14H13FINO4 — CID 168539198
5-[(4-fluoro-2-iodo-3-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168539198) has the molecular formula C14H13FINO4 and a molecular weight of 405.16 g/mol. Its IUPAC name is 5-[(4-fluoro-2-iodo-3-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-fluoro-2-iodo-3-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168539198 |
| Molecular Formula | C14H13FINO4 |
| Molecular Weight | 405.16 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 5-[(4-fluoro-2-iodo-3-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1c(F)ccc(NC=C2C(=O)OC(C)(C)OC2=O)c1I |
| InChI | InChI=1S/C14H13FINO4/c1-7-9(15)4-5-10(11(7)16)17-6-8-12(18)20-14(2,3)21-13(8)19/h4-6,17H,1-3H3 |
| InChIKey | DJKUWHZZWLMDQH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|