C27H35N3O6 — CID 168539360
5-[[3,5-bis(2-methylpiperidine-1-carbonyl)anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168539360) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is 5-[[3,5-bis(2-methylpiperidine-1-carbonyl)anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[3,5-bis(2-methylpiperidine-1-carbonyl)anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168539360 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 5-[[3,5-bis(2-methylpiperidine-1-carbonyl)anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1CCCCN1C(=O)c1cc(NC=C2C(=O)OC(C)(C)OC2=O)cc(C(=O)N2CCCCC2C)c1 |
| InChI | InChI=1S/C27H35N3O6/c1-17-9-5-7-11-29(17)23(31)19-13-20(24(32)30-12-8-6-10-18(30)2)15-21(14-19)28-16-22-25(33)35-27(3,4)36-26(22)34/h13-18,28H,5-12H2,1-4H3 |
| InChIKey | MZTYVYOQNGYBTN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|