C19H20N2O6 — CID 168539794
2-tert-butyl-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]isoindole-1,3-dione (PubChem CID 168539794) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-tert-butyl-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]isoindole-1,3-dione.
| Compound Name | 2-tert-butyl-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168539794 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-tert-butyl-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]isoindole-1,3-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)C(=O)O1 |
| InChI | InChI=1S/C19H20N2O6/c1-18(2,3)21-14(22)11-7-6-10(8-12(11)15(21)23)20-9-13-16(24)26-19(4,5)27-17(13)25/h6-9,20H,1-5H3 |
| InChIKey | XPUPZYLQZQLAHN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|