C14H10BrFN2O4 — CID 168539895
5-bromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-fluorobenzonitrile (PubChem CID 168539895) has the molecular formula C14H10BrFN2O4 and a molecular weight of 369.15 g/mol. Its IUPAC name is 5-bromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-fluorobenzonitrile.
| Compound Name | 5-bromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 168539895 |
| Molecular Formula | C14H10BrFN2O4 |
| Molecular Weight | 369.15 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 5-bromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-fluorobenzonitrile |
| SMILES | CC1(C)OC(=O)C(=CNc2cc(F)c(Br)cc2C#N)C(=O)O1 |
| InChI | InChI=1S/C14H10BrFN2O4/c1-14(2)21-12(19)8(13(20)22-14)6-18-11-4-10(16)9(15)3-7(11)5-17/h3-4,6,18H,1-2H3 |
| InChIKey | GESKJEPXJCVXIN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|