About (3,4-dichlorophenyl)urea
(3,4-dichlorophenyl)urea (PubChem CID 16854) has the molecular formula C7H6Cl2N2O
and a molecular weight of 205.04 g/mol. Its IUPAC name is (3,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)urea |
| PubChem CID | 16854 |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | (3,4-dichlorophenyl)urea |
| SMILES | NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2N2O/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12) |
| InChIKey | CYESCLHCWJKRKM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)urea?
The IUPAC name of (3,4-dichlorophenyl)urea (CID 16854) is (3,4-dichlorophenyl)urea.
What is the SMILES notation for (3,4-dichlorophenyl)urea?
The canonical SMILES for (3,4-dichlorophenyl)urea is NC(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of (3,4-dichlorophenyl)urea?
The InChIKey is CYESCLHCWJKRKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N2O/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12).
What are the key properties of (3,4-dichlorophenyl)urea?
(3,4-dichlorophenyl)urea has a molecular weight of 205.04 g/mol, XLogP of 2.48, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)urea is sourced from PubChem (CID 16854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).