C21H15F6NO5 — CID 168540695
5-[[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-fluoro-4-methylanilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168540695) has the molecular formula C21H15F6NO5 and a molecular weight of 475.34 g/mol. Its IUPAC name is 5-[[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-fluoro-4-methylanilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-fluoro-4-methylanilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168540695 |
| Molecular Formula | C21H15F6NO5 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 5-[[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-fluoro-4-methylanilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1cc(Oc2c(F)cc(C(F)(F)F)cc2F)c(NC=C2C(=O)OC(C)(C)OC2=O)cc1F |
| InChI | InChI=1S/C21H15F6NO5/c1-9-4-16(31-17-13(23)5-10(6-14(17)24)21(25,26)27)15(7-12(9)22)28-8-11-18(29)32-20(2,3)33-19(11)30/h4-8,28H,1-3H3 |
| InChIKey | IUUUNQGQKACDCO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|