C18H20N2O5 — CID 168541007
5-[[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168541007) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 5-[[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168541007 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 5-[[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc3c(c2)NC(=O)CC3(C)C)C(=O)O1 |
| InChI | InChI=1S/C18H20N2O5/c1-17(2)8-14(21)20-13-7-10(5-6-12(13)17)19-9-11-15(22)24-18(3,4)25-16(11)23/h5-7,9,19H,8H2,1-4H3,(H,20,21) |
| InChIKey | DYYWQAVVLASIFX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|