C23H30N2O6 — CID 168541042
(2,2,6,6-tetramethylpiperidin-4-yl) 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate (PubChem CID 168541042) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate |
|---|---|
| PubChem CID | 168541042 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(NC=C3C(=O)OC(C)(C)OC3=O)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H30N2O6/c1-21(2)11-16(12-22(3,4)25-21)29-18(26)14-7-9-15(10-8-14)24-13-17-19(27)30-23(5,6)31-20(17)28/h7-10,13,16,24-25H,11-12H2,1-6H3 |
| InChIKey | MKIZBQBVNJNRBU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|