C26H23N3O5 — CID 168541127
N-(4-anilinophenyl)-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide (PubChem CID 168541127) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-(4-anilinophenyl)-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide.
| Compound Name | N-(4-anilinophenyl)-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide |
|---|---|
| PubChem CID | 168541127 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-(4-anilinophenyl)-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide |
| SMILES | CC1(C)OC(=O)C(=CNc2cccc(C(=O)Nc3ccc(Nc4ccccc4)cc3)c2)C(=O)O1 |
| InChI | InChI=1S/C26H23N3O5/c1-26(2)33-24(31)22(25(32)34-26)16-27-21-10-6-7-17(15-21)23(30)29-20-13-11-19(12-14-20)28-18-8-4-3-5-9-18/h3-16,27-28H,1-2H3,(H,29,30) |
| InChIKey | PZEOJGVEEHGBTD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|