C17H17N3O5 — CID 168541142
2,2-dimethyl-5-[[3-(2-methyl-5-oxo-4H-imidazol-1-yl)anilino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168541142) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[3-(2-methyl-5-oxo-4H-imidazol-1-yl)anilino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[3-(2-methyl-5-oxo-4H-imidazol-1-yl)anilino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168541142 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2,2-dimethyl-5-[[3-(2-methyl-5-oxo-4H-imidazol-1-yl)anilino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1=NCC(=O)N1c1cccc(NC=C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C17H17N3O5/c1-10-18-9-14(21)20(10)12-6-4-5-11(7-12)19-8-13-15(22)24-17(2,3)25-16(13)23/h4-8,19H,9H2,1-3H3 |
| InChIKey | FBKQZVYTIKSPMI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|