C19H17N5 — CID 168541860
2-[[4-(2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-4-yl)anilino]methylidene]propanedinitrile (PubChem CID 168541860) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[[4-(2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-4-yl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-4-yl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168541860 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-[[4-(2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-4-yl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(C2CCNc3ccccc3N2)cc1 |
| InChI | InChI=1S/C19H17N5/c20-11-14(12-21)13-23-16-7-5-15(6-8-16)17-9-10-22-18-3-1-2-4-19(18)24-17/h1-8,13,17,22-24H,9-10H2 |
| InChIKey | PNUGKHQXKDDIPJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|