C13H11N7 — CID 168542259
2-[[2-methyl-5-(2-methyltetrazol-5-yl)anilino]methylidene]propanedinitrile (PubChem CID 168542259) has the molecular formula C13H11N7 and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-[[2-methyl-5-(2-methyltetrazol-5-yl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[2-methyl-5-(2-methyltetrazol-5-yl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542259 |
| Molecular Formula | C13H11N7 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-[[2-methyl-5-(2-methyltetrazol-5-yl)anilino]methylidene]propanedinitrile |
| SMILES | Cc1ccc(-c2nnn(C)n2)cc1NC=C(C#N)C#N |
| InChI | InChI=1S/C13H11N7/c1-9-3-4-11(13-17-19-20(2)18-13)5-12(9)16-8-10(6-14)7-15/h3-5,8,16H,1-2H3 |
| InChIKey | IUHLJJQBKPKGHF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 103.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|