C16H15N5O — CID 168543561
2-[[4-[(1,5-dimethylpyrazol-4-yl)methoxy]anilino]methylidene]propanedinitrile (PubChem CID 168543561) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[[4-[(1,5-dimethylpyrazol-4-yl)methoxy]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[(1,5-dimethylpyrazol-4-yl)methoxy]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543561 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[[4-[(1,5-dimethylpyrazol-4-yl)methoxy]anilino]methylidene]propanedinitrile |
| SMILES | Cc1c(COc2ccc(NC=C(C#N)C#N)cc2)cnn1C |
| InChI | InChI=1S/C16H15N5O/c1-12-14(10-20-21(12)2)11-22-16-5-3-15(4-6-16)19-9-13(7-17)8-18/h3-6,9-10,19H,11H2,1-2H3 |
| InChIKey | JLEVPKYZZWHCQY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|