C18H13N5 — CID 168544141
2-[[3-(1H-benzimidazol-2-yl)-2-methylanilino]methylidene]propanedinitrile (PubChem CID 168544141) has the molecular formula C18H13N5 and a molecular weight of 299.34 g/mol. Its IUPAC name is 2-[[3-(1H-benzimidazol-2-yl)-2-methylanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-(1H-benzimidazol-2-yl)-2-methylanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544141 |
| Molecular Formula | C18H13N5 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[[3-(1H-benzimidazol-2-yl)-2-methylanilino]methylidene]propanedinitrile |
| SMILES | Cc1c(NC=C(C#N)C#N)cccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H13N5/c1-12-14(18-22-16-6-2-3-7-17(16)23-18)5-4-8-15(12)21-11-13(9-19)10-20/h2-8,11,21H,1H3,(H,22,23) |
| InChIKey | DSXBFMRZENFDQH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|