C16H12ClN3O4S — CID 16854423
N-[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]-4-methylsulfonylbenzamide (PubChem CID 16854423) has the molecular formula C16H12ClN3O4S and a molecular weight of 377.81 g/mol. Its IUPAC name is N-[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]-4-methylsulfonylbenzamide.
| Compound Name | N-[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 16854423 |
| Molecular Formula | C16H12ClN3O4S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | N-[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2nnc(-c3cccc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C16H12ClN3O4S/c1-25(22,23)13-7-5-10(6-8-13)14(21)18-16-20-19-15(24-16)11-3-2-4-12(17)9-11/h2-9H,1H3,(H,18,20,21) |
| InChIKey | YXWAZOVXZYBFOA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |