About 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid
5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid (PubChem CID 168544278) has the molecular formula C14H16N4O3S
and a molecular weight of 320.37 g/mol. Its IUPAC name is 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid.
Molecular Properties
| Compound Name | 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid |
| PubChem CID | 168544278 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid |
| SMILES | CC(C)NCc1ccc(NC=C(C#N)C#N)cc1S(=O)(=O)O |
| InChI | InChI=1S/C14H16N4O3S/c1-10(2)17-9-12-3-4-13(5-14(12)22(19,20)21)18-8-11(6-15)7-16/h3-5,8,10,17-18H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | IEQFEUWWACPBEM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid?
The IUPAC name of 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid (CID 168544278) is 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid.
What is the SMILES notation for 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid?
The canonical SMILES for 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid is CC(C)NCc1ccc(NC=C(C#N)C#N)cc1S(=O)(=O)O.
What is the InChIKey of 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid?
The InChIKey is IEQFEUWWACPBEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O3S/c1-10(2)17-9-12-3-4-13(5-14(12)22(19,20)21)18-8-11(6-15)7-16/h3-5,8,10,17-18H,9H2,1-2H3,(H,19,20,21).
What are the key properties of 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid?
5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid has a molecular weight of 320.37 g/mol, XLogP of 1.77, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dicyanoethenylamino)-2-[(propan-2-ylamino)methyl]benzenesulfonic acid is sourced from PubChem (CID 168544278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).