C15H14N4O — CID 168544810
2-[[(4,4-dimethyl-3-oxo-1,2-dihydroisoquinolin-5-yl)amino]methylidene]propanedinitrile (PubChem CID 168544810) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[[(4,4-dimethyl-3-oxo-1,2-dihydroisoquinolin-5-yl)amino]methylidene]propanedinitrile.
| Compound Name | 2-[[(4,4-dimethyl-3-oxo-1,2-dihydroisoquinolin-5-yl)amino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544810 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-[[(4,4-dimethyl-3-oxo-1,2-dihydroisoquinolin-5-yl)amino]methylidene]propanedinitrile |
| SMILES | CC1(C)C(=O)NCc2cccc(NC=C(C#N)C#N)c21 |
| InChI | InChI=1S/C15H14N4O/c1-15(2)13-11(9-19-14(15)20)4-3-5-12(13)18-8-10(6-16)7-17/h3-5,8,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | RHJDTHVEFHFAEB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|