C27H28N2O3 — CID 168551548
2-[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]-3H-quinazolin-4-one (PubChem CID 168551548) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168551548 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]-3H-quinazolin-4-one |
| SMILES | COc1ccc(-c2nc3ccccc3c(=O)[nH]2)cc1COc1cc(C)ccc1C(C)(C)C |
| InChI | InChI=1S/C27H28N2O3/c1-17-10-12-21(27(2,3)4)24(14-17)32-16-19-15-18(11-13-23(19)31-5)25-28-22-9-7-6-8-20(22)26(30)29-25/h6-15H,16H2,1-5H3,(H,28,29,30) |
| InChIKey | YMHVPHJOHOSKQX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |