C28H23N3O — CID 168551652
2-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]-3H-quinazolin-4-one (PubChem CID 168551652) has the molecular formula C28H23N3O and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168551652 |
| Molecular Formula | C28H23N3O |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]-3H-quinazolin-4-one |
| SMILES | Cc1cccc(N(c2ccc(-c3nc4ccccc4c(=O)[nH]3)cc2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C28H23N3O/c1-19-7-5-9-23(17-19)31(24-10-6-8-20(2)18-24)22-15-13-21(14-16-22)27-29-26-12-4-3-11-25(26)28(32)30-27/h3-18H,1-2H3,(H,29,30,32) |
| InChIKey | NYYCWOWFRXIONI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |