C22H25N3O3 — CID 168552184
2-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]-3H-quinazolin-4-one (PubChem CID 168552184) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168552184 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]-3H-quinazolin-4-one |
| SMILES | COc1cc(-c2nc3ccccc3c(=O)[nH]2)ccc1OCCN1CCCCC1 |
| InChI | InChI=1S/C22H25N3O3/c1-27-20-15-16(21-23-18-8-4-3-7-17(18)22(26)24-21)9-10-19(20)28-14-13-25-11-5-2-6-12-25/h3-4,7-10,15H,2,5-6,11-14H2,1H3,(H,23,24,26) |
| InChIKey | YNZYXZFEVVGZPO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |