C15H12BrN3O4 — CID 168554064
2-(2-bromo-5,6-dimethoxy-3-nitrophenyl)-1H-benzimidazole (PubChem CID 168554064) has the molecular formula C15H12BrN3O4 and a molecular weight of 378.18 g/mol. Its IUPAC name is 2-(2-bromo-5,6-dimethoxy-3-nitrophenyl)-1H-benzimidazole.
| Compound Name | 2-(2-bromo-5,6-dimethoxy-3-nitrophenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 168554064 |
| Molecular Formula | C15H12BrN3O4 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 2-(2-bromo-5,6-dimethoxy-3-nitrophenyl)-1H-benzimidazole |
| SMILES | COc1cc([N+](=O)[O-])c(Br)c(-c2nc3ccccc3[nH]2)c1OC |
| InChI | InChI=1S/C15H12BrN3O4/c1-22-11-7-10(19(20)21)13(16)12(14(11)23-2)15-17-8-5-3-4-6-9(8)18-15/h3-7H,1-2H3,(H,17,18) |
| InChIKey | TZRDXNCGWPZEHG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|