About 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole
2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole (PubChem CID 168555055) has the molecular formula C18H16Br2N2O2
and a molecular weight of 452.15 g/mol. Its IUPAC name is 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole |
| PubChem CID | 168555055 |
| Molecular Formula | C18H16Br2N2O2 |
| Molecular Weight | 452.15 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole |
| SMILES | C=CCOc1c(OCC)cc(-c2nc3ccccc3[nH]2)c(Br)c1Br |
| InChI | InChI=1S/C18H16Br2N2O2/c1-3-9-24-17-14(23-4-2)10-11(15(19)16(17)20)18-21-12-7-5-6-8-13(12)22-18/h3,5-8,10H,1,4,9H2,2H3,(H,21,22) |
| InChIKey | NXTQXNAVZUTROJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.15 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole?
The IUPAC name of 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole (CID 168555055) is 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole.
What is the SMILES notation for 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole?
The canonical SMILES for 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole is C=CCOc1c(OCC)cc(-c2nc3ccccc3[nH]2)c(Br)c1Br.
What is the InChIKey of 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole?
The InChIKey is NXTQXNAVZUTROJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Br2N2O2/c1-3-9-24-17-14(23-4-2)10-11(15(19)16(17)20)18-21-12-7-5-6-8-13(12)22-18/h3,5-8,10H,1,4,9H2,2H3,(H,21,22).
What are the key properties of 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole?
2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole has a molecular weight of 452.15 g/mol, XLogP of 5.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)-1H-benzimidazole is sourced from PubChem (CID 168555055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).