C12H9Cl3N2O3 — CID 168555975
1-(2-hydroxyethyl)-3-(2,4,6-trichloroanilino)pyrrole-2,5-dione (PubChem CID 168555975) has the molecular formula C12H9Cl3N2O3 and a molecular weight of 335.57 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(2,4,6-trichloroanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-(2,4,6-trichloroanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168555975 |
| Molecular Formula | C12H9Cl3N2O3 |
| Molecular Weight | 335.57 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(2,4,6-trichloroanilino)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2c(Cl)cc(Cl)cc2Cl)C(=O)N1CCO |
| InChI | InChI=1S/C12H9Cl3N2O3/c13-6-3-7(14)11(8(15)4-6)16-9-5-10(19)17(1-2-18)12(9)20/h3-5,16,18H,1-2H2 |
| InChIKey | IJYYLRCTVZYJKC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|