C17H19N3O4 — CID 168556796
3-[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168556796) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556796 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | CC1(C)CC(=O)Nc2cc(NC3=CC(=O)N(CCO)C3=O)ccc21 |
| InChI | InChI=1S/C17H19N3O4/c1-17(2)9-14(22)19-12-7-10(3-4-11(12)17)18-13-8-15(23)20(5-6-21)16(13)24/h3-4,7-8,18,21H,5-6,9H2,1-2H3,(H,19,22) |
| InChIKey | MVEXERIWPZAXOR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|