C13H9F3N2O5 — CID 168557787
1-(2-hydroxyethyl)-3-[(2,2,6-trifluoro-1,3-benzodioxol-5-yl)amino]pyrrole-2,5-dione (PubChem CID 168557787) has the molecular formula C13H9F3N2O5 and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[(2,2,6-trifluoro-1,3-benzodioxol-5-yl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[(2,2,6-trifluoro-1,3-benzodioxol-5-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557787 |
| Molecular Formula | C13H9F3N2O5 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[(2,2,6-trifluoro-1,3-benzodioxol-5-yl)amino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc3c(cc2F)OC(F)(F)O3)C(=O)N1CCO |
| InChI | InChI=1S/C13H9F3N2O5/c14-6-3-9-10(23-13(15,16)22-9)4-7(6)17-8-5-11(20)18(1-2-19)12(8)21/h3-5,17,19H,1-2H2 |
| InChIKey | NPELLNSIZDHWSL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|