C17H15N3O5 — CID 168558901
2-cyclopropyl-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]isoindole-1,3-dione (PubChem CID 168558901) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is 2-cyclopropyl-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]isoindole-1,3-dione.
| Compound Name | 2-cyclopropyl-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168558901 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-cyclopropyl-5-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]isoindole-1,3-dione |
| SMILES | O=C1C=C(Nc2ccc3c(c2)C(=O)N(C2CC2)C3=O)C(=O)N1CCO |
| InChI | InChI=1S/C17H15N3O5/c21-6-5-19-14(22)8-13(17(19)25)18-9-1-4-11-12(7-9)16(24)20(15(11)23)10-2-3-10/h1,4,7-8,10,18,21H,2-3,5-6H2 |
| InChIKey | ICLBDHBAAGEQSJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|