C14H9ClF4N2O5 — CID 168559145
3-[(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168559145) has the molecular formula C14H9ClF4N2O5 and a molecular weight of 396.68 g/mol. Its IUPAC name is 3-[(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559145 |
| Molecular Formula | C14H9ClF4N2O5 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 3-[(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc3c(cc2Cl)OC(F)(F)C(F)(F)O3)C(=O)N1CCO |
| InChI | InChI=1S/C14H9ClF4N2O5/c15-6-3-9-10(26-14(18,19)13(16,17)25-9)4-7(6)20-8-5-11(23)21(1-2-22)12(8)24/h3-5,20,22H,1-2H2 |
| InChIKey | QLDVPVYWXGLMDG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|