C14H17N3O5S — CID 168559899
2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3,5-dimethylbenzenesulfonamide (PubChem CID 168559899) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3,5-dimethylbenzenesulfonamide.
| Compound Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 168559899 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]-3,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(NC2=CC(=O)N(CCO)C2=O)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H17N3O5S/c1-8-5-9(2)13(11(6-8)23(15,21)22)16-10-7-12(19)17(3-4-18)14(10)20/h5-7,16,18H,3-4H2,1-2H3,(H2,15,21,22) |
| InChIKey | KBOCMEAXCMCQOJ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|