C14H16ClN3O4 — CID 168561679
methyl 4-(4-amino-3-chloroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168561679) has the molecular formula C14H16ClN3O4 and a molecular weight of 325.75 g/mol. Its IUPAC name is methyl 4-(4-amino-3-chloroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(4-amino-3-chloroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561679 |
| Molecular Formula | C14H16ClN3O4 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | methyl 4-(4-amino-3-chloroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(N)c(Cl)c2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C14H16ClN3O4/c1-22-14(21)9-7-18(4-5-19)13(20)12(9)17-8-2-3-11(16)10(15)6-8/h2-3,6,17,19H,4-5,7,16H2,1H3 |
| InChIKey | AGKQHBMDKABBRF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|