C26H21N3O6 — CID 168563165
methyl 1-(2-hydroxyethyl)-4-[(2-naphthalen-2-yl-1,3-dioxoisoindol-5-yl)amino]-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168563165) has the molecular formula C26H21N3O6 and a molecular weight of 471.47 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-4-[(2-naphthalen-2-yl-1,3-dioxoisoindol-5-yl)amino]-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-4-[(2-naphthalen-2-yl-1,3-dioxoisoindol-5-yl)amino]-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168563165 |
| Molecular Formula | C26H21N3O6 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-4-[(2-naphthalen-2-yl-1,3-dioxoisoindol-5-yl)amino]-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc3c(c2)C(=O)N(c2ccc4ccccc4c2)C3=O)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C26H21N3O6/c1-35-26(34)21-14-28(10-11-30)25(33)22(21)27-17-7-9-19-20(13-17)24(32)29(23(19)31)18-8-6-15-4-2-3-5-16(15)12-18/h2-9,12-13,27,30H,10-11,14H2,1H3 |
| InChIKey | GORXERAVHDFCBQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|