C19H19N3O5 — CID 168565140
methyl 1-(2-hydroxyethyl)-5-oxo-4-(3-pyridin-2-yloxyanilino)-2H-pyrrole-3-carboxylate (PubChem CID 168565140) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-5-oxo-4-(3-pyridin-2-yloxyanilino)-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-(3-pyridin-2-yloxyanilino)-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168565140 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-(3-pyridin-2-yloxyanilino)-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cccc(Oc3ccccn3)c2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C19H19N3O5/c1-26-19(25)15-12-22(9-10-23)18(24)17(15)21-13-5-4-6-14(11-13)27-16-7-2-3-8-20-16/h2-8,11,21,23H,9-10,12H2,1H3 |
| InChIKey | HNDYHGJJRIMMER-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |