About dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate
dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate (PubChem CID 168566996) has the molecular formula C19H22N2O6
and a molecular weight of 374.39 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate |
| PubChem CID | 168566996 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate |
| SMILES | CCC1(c2ccc(N/C(=C/C(=O)OC)C(=O)OC)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C19H22N2O6/c1-4-19(10-9-15(22)21-18(19)25)12-5-7-13(8-6-12)20-14(17(24)27-3)11-16(23)26-2/h5-8,11,20H,4,9-10H2,1-3H3,(H,21,22,25)/b14-11+ |
| InChIKey | YXHDSDDRROYOSU-SDNWHVSQSA-N |
| XLogP | 1.41 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate?
The IUPAC name of dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate (CID 168566996) is dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate.
What is the SMILES notation for dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate?
The canonical SMILES for dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate is CCC1(c2ccc(N/C(=C/C(=O)OC)C(=O)OC)cc2)CCC(=O)NC1=O.
What is the InChIKey of dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate?
The InChIKey is YXHDSDDRROYOSU-SDNWHVSQSA-N. The full InChI is InChI=1S/C19H22N2O6/c1-4-19(10-9-15(22)21-18(19)25)12-5-7-13(8-6-12)20-14(17(24)27-3)11-16(23)26-2/h5-8,11,20H,4,9-10H2,1-3H3,(H,21,22,25)/b14-11+.
What are the key properties of dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate?
dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate has a molecular weight of 374.39 g/mol, XLogP of 1.41, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)anilino]but-2-enedioate is sourced from PubChem (CID 168566996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).