About dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate
dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate (PubChem CID 168567887) has the molecular formula C15H15FN2O5
and a molecular weight of 322.29 g/mol. Its IUPAC name is dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate |
| PubChem CID | 168567887 |
| Molecular Formula | C15H15FN2O5 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(F)c2c(c1)CCC(=O)N2)C(=O)OC |
| InChI | InChI=1S/C15H15FN2O5/c1-22-13(20)7-11(15(21)23-2)17-9-5-8-3-4-12(19)18-14(8)10(16)6-9/h5-7,17H,3-4H2,1-2H3,(H,18,19)/b11-7+ |
| InChIKey | LATSKJADNCKQJL-YRNVUSSQSA-N |
| XLogP | 1.35 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate?
The IUPAC name of dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate (CID 168567887) is dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate.
What is the SMILES notation for dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate?
The canonical SMILES for dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate is COC(=O)/C=C(/Nc1cc(F)c2c(c1)CCC(=O)N2)C(=O)OC.
What is the InChIKey of dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate?
The InChIKey is LATSKJADNCKQJL-YRNVUSSQSA-N. The full InChI is InChI=1S/C15H15FN2O5/c1-22-13(20)7-11(15(21)23-2)17-9-5-8-3-4-12(19)18-14(8)10(16)6-9/h5-7,17H,3-4H2,1-2H3,(H,18,19)/b11-7+.
What are the key properties of dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate?
dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate has a molecular weight of 322.29 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-2-[(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]but-2-enedioate is sourced from PubChem (CID 168567887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).