C18H14Cl2N2O7S — CID 168568199
3,6-dichloro-8-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-9H-carbazole-1-sulfonic acid (PubChem CID 168568199) has the molecular formula C18H14Cl2N2O7S and a molecular weight of 473.29 g/mol. Its IUPAC name is 3,6-dichloro-8-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-9H-carbazole-1-sulfonic acid.
| Compound Name | 3,6-dichloro-8-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-9H-carbazole-1-sulfonic acid |
|---|---|
| PubChem CID | 168568199 |
| Molecular Formula | C18H14Cl2N2O7S |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 3,6-dichloro-8-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-9H-carbazole-1-sulfonic acid |
| SMILES | COC(=O)/C=C(/Nc1cc(Cl)cc2c1[nH]c1c(S(=O)(=O)O)cc(Cl)cc12)C(=O)OC |
| InChI | InChI=1S/C18H14Cl2N2O7S/c1-28-15(23)7-13(18(24)29-2)21-12-5-8(19)3-10-11-4-9(20)6-14(30(25,26)27)17(11)22-16(10)12/h3-7,21-22H,1-2H3,(H,25,26,27)/b13-7+ |
| InChIKey | SHRPFUJDVSSCRB-NTUHNPAUSA-N |
| XLogP | 3.52 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|