C17H13F2N3O2S — CID 168574188
2-[[4-[(2,6-difluorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574188) has the molecular formula C17H13F2N3O2S and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-[[4-[(2,6-difluorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[4-[(2,6-difluorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574188 |
| Molecular Formula | C17H13F2N3O2S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-[[4-[(2,6-difluorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2ccc(OCc3c(F)cccc3F)cc2)N1 |
| InChI | InChI=1S/C17H13F2N3O2S/c18-14-2-1-3-15(19)13(14)9-24-12-6-4-11(5-7-12)8-20-22-17-21-16(23)10-25-17/h1-8H,9-10H2,(H,21,22,23) |
| InChIKey | BFOCIRJXJNKVMY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|