C15H19N3OS2 — CID 168574258
2-[(3-pentylsulfanylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574258) has the molecular formula C15H19N3OS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-[(3-pentylsulfanylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(3-pentylsulfanylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574258 |
| Molecular Formula | C15H19N3OS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[(3-pentylsulfanylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCCCSc1cccc(C=NN=C2NC(=O)CS2)c1 |
| InChI | InChI=1S/C15H19N3OS2/c1-2-3-4-8-20-13-7-5-6-12(9-13)10-16-18-15-17-14(19)11-21-15/h5-7,9-10H,2-4,8,11H2,1H3,(H,17,18,19) |
| InChIKey | PBCRPGWLOSWJOC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|