C16H20N4OS — CID 168574340
2-[[2-(piperidin-1-ylmethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574340) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-[[2-(piperidin-1-ylmethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[2-(piperidin-1-ylmethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574340 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[[2-(piperidin-1-ylmethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2ccccc2CN2CCCCC2)N1 |
| InChI | InChI=1S/C16H20N4OS/c21-15-12-22-16(18-15)19-17-10-13-6-2-3-7-14(13)11-20-8-4-1-5-9-20/h2-3,6-7,10H,1,4-5,8-9,11-12H2,(H,18,19,21) |
| InChIKey | ABSUJNWPJBGEJG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|