C12H9F4N3O2S — CID 168574748
2-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574748) has the molecular formula C12H9F4N3O2S and a molecular weight of 335.28 g/mol. Its IUPAC name is 2-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574748 |
| Molecular Formula | C12H9F4N3O2S |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2ccccc2OC(F)(F)C(F)F)N1 |
| InChI | InChI=1S/C12H9F4N3O2S/c13-10(14)12(15,16)21-8-4-2-1-3-7(8)5-17-19-11-18-9(20)6-22-11/h1-5,10H,6H2,(H,18,19,20) |
| InChIKey | MZHYQDHJRXTAFW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|