C12H13N3O3S2 — CID 168575362
2-[[4-(methylsulfonylmethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168575362) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-[[4-(methylsulfonylmethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[4-(methylsulfonylmethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168575362 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-[[4-(methylsulfonylmethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CS(=O)(=O)Cc1ccc(C=NN=C2NC(=O)CS2)cc1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-20(17,18)8-10-4-2-9(3-5-10)6-13-15-12-14-11(16)7-19-12/h2-6H,7-8H2,1H3,(H,14,15,16) |
| InChIKey | BYVCBORHSONHOF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|