C12H8N4O2S — CID 168576387
2-[(3-oxoisoindol-5-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168576387) has the molecular formula C12H8N4O2S and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-[(3-oxoisoindol-5-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(3-oxoisoindol-5-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168576387 |
| Molecular Formula | C12H8N4O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-[(3-oxoisoindol-5-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2ccc3c(c2)C(=O)N=C3)N1 |
| InChI | InChI=1S/C12H8N4O2S/c17-10-6-19-12(15-10)16-14-4-7-1-2-8-5-13-11(18)9(8)3-7/h1-5H,6H2,(H,15,16,17) |
| InChIKey | CKPOHDKGNJREOR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|