C13H10ClN3O2S — CID 168576567
2-[(3-chloro-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168576567) has the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. Its IUPAC name is 2-[(3-chloro-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(3-chloro-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168576567 |
| Molecular Formula | C13H10ClN3O2S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-[(3-chloro-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1ccc(C=NN=C2NC(=O)CS2)cc1Cl |
| InChI | InChI=1S/C13H10ClN3O2S/c1-2-5-19-11-4-3-9(6-10(11)14)7-15-17-13-16-12(18)8-20-13/h1,3-4,6-7H,5,8H2,(H,16,17,18) |
| InChIKey | HGTOQJCWLHNLLJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|